C11H20O11S2 — CID 11703850
[(2S,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxan-3-yl] sulfate (PubChem CID 11703850) has the molecular formula C11H20O11S2 and a molecular weight of 392.40 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxan-3-yl] sulfate.
| Compound Name | [(2S,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxan-3-yl] sulfate |
|---|---|
| PubChem CID | 11703850 |
| Molecular Formula | C11H20O11S2 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [(2S,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@@H]1[C@H](O)[C@@H](O)C(O)O[C@@H]1C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C11H20O11S2/c12-1-6-7(14)4(13)2-23(6)3-5-10(22-24(18,19)20)8(15)9(16)11(17)21-5/h4-17H,1-3H2/t4-,5-,6-,7+,8-,9-,10+,11?,23?/m1/s1 |
| InChIKey | ABYQELPAYUGECF-QUDFYWQPSA-N |
| XLogP | -5.01 |
| TPSA | 197.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|