About (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal
(2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal (PubChem CID 11703900) has the molecular formula C19H22O5S2
and a molecular weight of 394.51 g/mol. Its IUPAC name is (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal.
Molecular Properties
| Compound Name | (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal |
| PubChem CID | 11703900 |
| Molecular Formula | C19H22O5S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal |
| SMILES | CC(C)[C@H](C=O)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22O5S2/c1-15(2)16(14-20)13-19(25(21,22)17-9-5-3-6-10-17)26(23,24)18-11-7-4-8-12-18/h3-12,14-16,19H,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | XXLAQXQOERAAKV-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal?
The IUPAC name of (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal (CID 11703900) is (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal.
What is the SMILES notation for (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal?
The canonical SMILES for (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal is CC(C)[C@H](C=O)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal?
The InChIKey is XXLAQXQOERAAKV-INIZCTEOSA-N. The full InChI is InChI=1S/C19H22O5S2/c1-15(2)16(14-20)13-19(25(21,22)17-9-5-3-6-10-17)26(23,24)18-11-7-4-8-12-18/h3-12,14-16,19H,13H2,1-2H3/t16-/m0/s1.
What are the key properties of (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal?
(2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal has a molecular weight of 394.51 g/mol, XLogP of 3.12, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-bis(benzenesulfonyl)-2-propan-2-ylbutanal is sourced from PubChem (CID 11703900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).