C22H26O7 — CID 11704081
[(4S,5S,7E,10R,11R)-8-hydroxy-7-methyl-6,9,13-trioxo-4,10-bis(prop-1-en-2-yl)-12-oxabicyclo[9.2.1]tetradeca-1(14),7-dien-5-yl] acetate (PubChem CID 11704081) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(4S,5S,7E,10R,11R)-8-hydroxy-7-methyl-6,9,13-trioxo-4,10-bis(prop-1-en-2-yl)-12-oxabicyclo[9.2.1]tetradeca-1(14),7-dien-5-yl] acetate.
| Compound Name | [(4S,5S,7E,10R,11R)-8-hydroxy-7-methyl-6,9,13-trioxo-4,10-bis(prop-1-en-2-yl)-12-oxabicyclo[9.2.1]tetradeca-1(14),7-dien-5-yl] acetate |
|---|---|
| PubChem CID | 11704081 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(4S,5S,7E,10R,11R)-8-hydroxy-7-methyl-6,9,13-trioxo-4,10-bis(prop-1-en-2-yl)-12-oxabicyclo[9.2.1]tetradeca-1(14),7-dien-5-yl] acetate |
| SMILES | C=C(C)[C@H]1C(=O)/C(O)=C(/C)C(=O)[C@@H](OC(C)=O)[C@H](C(=C)C)CCC2=C[C@H]1OC2=O |
| InChI | InChI=1S/C22H26O7/c1-10(2)15-8-7-14-9-16(29-22(14)27)17(11(3)4)20(26)18(24)12(5)19(25)21(15)28-13(6)23/h9,15-17,21,24H,1,3,7-8H2,2,4-6H3/b18-12+/t15-,16+,17+,21-/m0/s1 |
| InChIKey | KFOAFRGWCVUHFY-XPIXLHGCSA-N |
| XLogP | 2.92 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|