About ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate
ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate (PubChem CID 11704136) has the molecular formula C18H13BrO6
and a molecular weight of 405.20 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate |
| PubChem CID | 11704136 |
| Molecular Formula | C18H13BrO6 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cc(O)cc(O)c2c(=O)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H13BrO6/c1-2-24-18(23)17-14(9-3-5-10(19)6-4-9)16(22)15-12(21)7-11(20)8-13(15)25-17/h3-8,20-21H,2H2,1H3 |
| InChIKey | YGWPVDDZRPBELC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate?
The IUPAC name of ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate (CID 11704136) is ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate.
What is the SMILES notation for ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate?
The canonical SMILES for ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate is CCOC(=O)c1oc2cc(O)cc(O)c2c(=O)c1-c1ccc(Br)cc1.
What is the InChIKey of ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate?
The InChIKey is YGWPVDDZRPBELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO6/c1-2-24-18(23)17-14(9-3-5-10(19)6-4-9)16(22)15-12(21)7-11(20)8-13(15)25-17/h3-8,20-21H,2H2,1H3.
What are the key properties of ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate?
ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate has a molecular weight of 405.20 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-bromophenyl)-5,7-dihydroxy-4-oxochromene-2-carboxylate is sourced from PubChem (CID 11704136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).