C13H16N2S — CID 117041417
1-N,4-N-dimethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-diamine (PubChem CID 117041417) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-dimethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 117041417 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-N,4-N-dimethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-diamine |
| SMILES | CNc1ccc(N(C)Cc2cccs2)cc1 |
| InChI | InChI=1S/C13H16N2S/c1-14-11-5-7-12(8-6-11)15(2)10-13-4-3-9-16-13/h3-9,14H,10H2,1-2H3 |
| InChIKey | SILNAHKHVLPHIF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|