C14H14F2N2 — CID 117041619
N-[4-(aminomethyl)phenyl]-2,5-difluoro-N-methylaniline (PubChem CID 117041619) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-2,5-difluoro-N-methylaniline.
| Compound Name | N-[4-(aminomethyl)phenyl]-2,5-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 117041619 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-2,5-difluoro-N-methylaniline |
| SMILES | CN(c1ccc(CN)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H14F2N2/c1-18(12-5-2-10(9-17)3-6-12)14-8-11(15)4-7-13(14)16/h2-8H,9,17H2,1H3 |
| InChIKey | VDLLZYCFBKOWKV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |