C19H24F2N6O2 — CID 11704166
[(3S,4R)-3,4-difluoropyrrolidin-1-yl]-[(2S,4S)-4-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pyrrolidin-2-yl]methanone (PubChem CID 11704166) has the molecular formula C19H24F2N6O2 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(3S,4R)-3,4-difluoropyrrolidin-1-yl]-[(2S,4S)-4-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pyrrolidin-2-yl]methanone.
| Compound Name | [(3S,4R)-3,4-difluoropyrrolidin-1-yl]-[(2S,4S)-4-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 11704166 |
| Molecular Formula | C19H24F2N6O2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(3S,4R)-3,4-difluoropyrrolidin-1-yl]-[(2S,4S)-4-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pyrrolidin-2-yl]methanone |
| SMILES | O=C([C@@H]1C[C@H](N2CCN(c3nc4cccnc4o3)CC2)CN1)N1C[C@@H](F)[C@@H](F)C1 |
| InChI | InChI=1S/C19H24F2N6O2/c20-13-10-27(11-14(13)21)18(28)16-8-12(9-23-16)25-4-6-26(7-5-25)19-24-15-2-1-3-22-17(15)29-19/h1-3,12-14,16,23H,4-11H2/t12-,13-,14+,16-/m0/s1 |
| InChIKey | MXCDBKWDLSYTJY-AYDFFVQHSA-N |
| XLogP | 0.59 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |