C15H23NO2 — CID 117042175
3-[methyl-[(4-propan-2-ylphenyl)methyl]amino]butanoic acid (PubChem CID 117042175) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-[methyl-[(4-propan-2-ylphenyl)methyl]amino]butanoic acid.
| Compound Name | 3-[methyl-[(4-propan-2-ylphenyl)methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 117042175 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-[methyl-[(4-propan-2-ylphenyl)methyl]amino]butanoic acid |
| SMILES | CC(C)c1ccc(CN(C)C(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-11(2)14-7-5-13(6-8-14)10-16(4)12(3)9-15(17)18/h5-8,11-12H,9-10H2,1-4H3,(H,17,18) |
| InChIKey | AVCJFICLZIRSCC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |