About 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile
6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile (PubChem CID 117043158) has the molecular formula C9H7N3OS
and a molecular weight of 205.24 g/mol. Its IUPAC name is 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile |
| PubChem CID | 117043158 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile |
| SMILES | N#CN1C(=O)CSc2ccc(N)cc21 |
| InChI | InChI=1S/C9H7N3OS/c10-5-12-7-3-6(11)1-2-8(7)14-4-9(12)13/h1-3H,4,11H2 |
| InChIKey | SPLQESUYOYZTSL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile?
The IUPAC name of 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile (CID 117043158) is 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile.
What is the SMILES notation for 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile?
The canonical SMILES for 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile is N#CN1C(=O)CSc2ccc(N)cc21.
What is the InChIKey of 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile?
The InChIKey is SPLQESUYOYZTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3OS/c10-5-12-7-3-6(11)1-2-8(7)14-4-9(12)13/h1-3H,4,11H2.
What are the key properties of 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile?
6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile has a molecular weight of 205.24 g/mol, XLogP of 1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-oxo-1,4-benzothiazine-4-carbonitrile is sourced from PubChem (CID 117043158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).