About (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide
(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide (PubChem CID 117043257) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide.
Molecular Properties
| Compound Name | (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide |
| PubChem CID | 117043257 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide |
| SMILES | CN(C#N)c1ccc2c(c1)CCCS2(=O)=O |
| InChI | InChI=1S/C11H12N2O2S/c1-13(8-12)10-4-5-11-9(7-10)3-2-6-16(11,14)15/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | JMMQKFFLEYJWLH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide?
The IUPAC name of (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide (CID 117043257) is (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide.
What is the SMILES notation for (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide?
The canonical SMILES for (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide is CN(C#N)c1ccc2c(c1)CCCS2(=O)=O.
What is the InChIKey of (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide?
The InChIKey is JMMQKFFLEYJWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-13(8-12)10-4-5-11-9(7-10)3-2-6-16(11,14)15/h4-5,7H,2-3,6H2,1H3.
What are the key properties of (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide?
(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide has a molecular weight of 236.30 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-methylcyanamide is sourced from PubChem (CID 117043257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).