About N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 11704438) has the molecular formula C21H20F3N3O3
and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| PubChem CID | 11704438 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C1COc2ccc(NC(=O)C3CCN(c4ccccc4C(F)(F)F)CC3)cc2N1 |
| InChI | InChI=1S/C21H20F3N3O3/c22-21(23,24)15-3-1-2-4-17(15)27-9-7-13(8-10-27)20(29)25-14-5-6-18-16(11-14)26-19(28)12-30-18/h1-6,11,13H,7-10,12H2,(H,25,29)(H,26,28) |
| InChIKey | DLQYCUAUNGADOX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide?
The IUPAC name of N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide (CID 11704438) is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
What is the SMILES notation for N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide?
The canonical SMILES for N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide is O=C1COc2ccc(NC(=O)C3CCN(c4ccccc4C(F)(F)F)CC3)cc2N1.
What is the InChIKey of N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide?
The InChIKey is DLQYCUAUNGADOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3N3O3/c22-21(23,24)15-3-1-2-4-17(15)27-9-7-13(8-10-27)20(29)25-14-5-6-18-16(11-14)26-19(28)12-30-18/h1-6,11,13H,7-10,12H2,(H,25,29)(H,26,28).
What are the key properties of N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide?
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide has a molecular weight of 419.40 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide is sourced from PubChem (CID 11704438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).