C23H33NO4S — CID 11704448
3-phenylpropyl (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 11704448) has the molecular formula C23H33NO4S and a molecular weight of 419.59 g/mol. Its IUPAC name is 3-phenylpropyl (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | 3-phenylpropyl (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11704448 |
| Molecular Formula | C23H33NO4S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3-phenylpropyl (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCCC(=O)C(=O)N1[C@H](C(=O)OCCCc2ccccc2)CSC1(C)C |
| InChI | InChI=1S/C23H33NO4S/c1-4-5-6-10-15-20(25)21(26)24-19(17-29-23(24,2)3)22(27)28-16-11-14-18-12-8-7-9-13-18/h7-9,12-13,19H,4-6,10-11,14-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | QVJPICZEWJRMCF-IBGZPJMESA-N |
| XLogP | 4.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|