C8H15N5S — CID 117045202
N-methyl-1-[1-(thiatriazol-5-yl)piperidin-3-yl]methanamine (PubChem CID 117045202) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is N-methyl-1-[1-(thiatriazol-5-yl)piperidin-3-yl]methanamine.
| Compound Name | N-methyl-1-[1-(thiatriazol-5-yl)piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117045202 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-methyl-1-[1-(thiatriazol-5-yl)piperidin-3-yl]methanamine |
| SMILES | CNCC1CCCN(c2nnns2)C1 |
| InChI | InChI=1S/C8H15N5S/c1-9-5-7-3-2-4-13(6-7)8-10-11-12-14-8/h7,9H,2-6H2,1H3 |
| InChIKey | MBZJYQGEJOTILZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |