C13H15NO — CID 117045336
2-(2-azabicyclo[4.1.0]heptan-2-yl)benzaldehyde (PubChem CID 117045336) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(2-azabicyclo[4.1.0]heptan-2-yl)benzaldehyde.
| Compound Name | 2-(2-azabicyclo[4.1.0]heptan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 117045336 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-(2-azabicyclo[4.1.0]heptan-2-yl)benzaldehyde |
| SMILES | O=Cc1ccccc1N1CCCC2CC21 |
| InChI | InChI=1S/C13H15NO/c15-9-11-4-1-2-6-12(11)14-7-3-5-10-8-13(10)14/h1-2,4,6,9-10,13H,3,5,7-8H2 |
| InChIKey | JXEFSJYEYNTGFD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|