About 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea
1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea (PubChem CID 11704565) has the molecular formula C18H18BrClN2OS
and a molecular weight of 425.78 g/mol. Its IUPAC name is 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea.
Molecular Properties
| Compound Name | 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea |
| PubChem CID | 11704565 |
| Molecular Formula | C18H18BrClN2OS |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea |
| SMILES | CC1(C)CC(NC(=S)Nc2cccc(Cl)c2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C18H18BrClN2OS/c1-18(2)10-15(14-8-11(19)6-7-16(14)23-18)22-17(24)21-13-5-3-4-12(20)9-13/h3-9,15H,10H2,1-2H3,(H2,21,22,24) |
| InChIKey | SBLLOSAMWVFIDV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea?
The IUPAC name of 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea (CID 11704565) is 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea.
What is the SMILES notation for 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea?
The canonical SMILES for 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea is CC1(C)CC(NC(=S)Nc2cccc(Cl)c2)c2cc(Br)ccc2O1.
What is the InChIKey of 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea?
The InChIKey is SBLLOSAMWVFIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrClN2OS/c1-18(2)10-15(14-8-11(19)6-7-16(14)23-18)22-17(24)21-13-5-3-4-12(20)9-13/h3-9,15H,10H2,1-2H3,(H2,21,22,24).
What are the key properties of 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea?
1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea has a molecular weight of 425.78 g/mol, XLogP of 5.69, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-chlorophenyl)thiourea is sourced from PubChem (CID 11704565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).