C13H19NO3 — CID 117045656
tert-butyl 7-formyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 117045656) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl 7-formyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | tert-butyl 7-formyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 117045656 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | tert-butyl 7-formyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C=O)C2CC1C1CC21 |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)14-10-5-9(11(14)6-15)7-4-8(7)10/h6-11H,4-5H2,1-3H3 |
| InChIKey | IIOBIIISHFPDQE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|