C12H17NO2 — CID 117045878
2,2,3,3-tetramethyl-1,4-benzodioxin-6-amine (PubChem CID 117045878) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1,4-benzodioxin-6-amine.
| Compound Name | 2,2,3,3-tetramethyl-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 117045878 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2,2,3,3-tetramethyl-1,4-benzodioxin-6-amine |
| SMILES | CC1(C)Oc2ccc(N)cc2OC1(C)C |
| InChI | InChI=1S/C12H17NO2/c1-11(2)12(3,4)15-10-7-8(13)5-6-9(10)14-11/h5-7H,13H2,1-4H3 |
| InChIKey | FYSLEEWESVMIFO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|