About 5-azatricyclo[4.1.0.02,4]heptane
5-azatricyclo[4.1.0.02,4]heptane (PubChem CID 117045887) has the molecular formula C6H9N
and a molecular weight of 95.15 g/mol. Its IUPAC name is 5-azatricyclo[4.1.0.02,4]heptane.
Molecular Properties
| Compound Name | 5-azatricyclo[4.1.0.02,4]heptane |
| PubChem CID | 117045887 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.15 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | 5-azatricyclo[4.1.0.02,4]heptane |
| SMILES | C1C2NC3CC3C12 |
| InChI | InChI=1S/C6H9N/c1-3-4-2-6(4)7-5(1)3/h3-7H,1-2H2 |
| InChIKey | MYGNYZYPCFEZJB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-azatricyclo[4.1.0.02,4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azatricyclo[4.1.0.02,4]heptane?
The IUPAC name of 5-azatricyclo[4.1.0.02,4]heptane (CID 117045887) is 5-azatricyclo[4.1.0.02,4]heptane.
What is the SMILES notation for 5-azatricyclo[4.1.0.02,4]heptane?
The canonical SMILES for 5-azatricyclo[4.1.0.02,4]heptane is C1C2NC3CC3C12.
What is the InChIKey of 5-azatricyclo[4.1.0.02,4]heptane?
The InChIKey is MYGNYZYPCFEZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N/c1-3-4-2-6(4)7-5(1)3/h3-7H,1-2H2.
What are the key properties of 5-azatricyclo[4.1.0.02,4]heptane?
5-azatricyclo[4.1.0.02,4]heptane has a molecular weight of 95.15 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azatricyclo[4.1.0.02,4]heptane is sourced from PubChem (CID 117045887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).