C14H18N2O — CID 117045936
2-amino-1-(2-azabicyclo[4.1.0]heptan-2-yl)-2-phenylethanone (PubChem CID 117045936) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-amino-1-(2-azabicyclo[4.1.0]heptan-2-yl)-2-phenylethanone.
| Compound Name | 2-amino-1-(2-azabicyclo[4.1.0]heptan-2-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 117045936 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-amino-1-(2-azabicyclo[4.1.0]heptan-2-yl)-2-phenylethanone |
| SMILES | NC(C(=O)N1CCCC2CC21)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O/c15-13(10-5-2-1-3-6-10)14(17)16-8-4-7-11-9-12(11)16/h1-3,5-6,11-13H,4,7-9,15H2 |
| InChIKey | FAZXDNAJMVSTAG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |