C24H36F3NO2 — CID 11704608
(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-ol (PubChem CID 11704608) has the molecular formula C24H36F3NO2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-ol.
| Compound Name | (2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 11704608 |
| Molecular Formula | C24H36F3NO2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | (2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-ol |
| SMILES | CCCC[C@](O)([C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H36F3NO2/c1-5-6-14-23(29,24(25,26)27)21-28(16-18-10-8-7-9-11-18)22(3,4)19-13-12-17(2)15-20(19)30-21/h7-11,17,19-21,29H,5-6,12-16H2,1-4H3/t17-,19-,20-,21+,23+/m1/s1 |
| InChIKey | ZAFVTKGCBDJVIE-WKALQJFBSA-N |
| XLogP | 5.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |