About 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one
5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 117046400) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 117046400 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2c(O)ccc(O)c21 |
| InChI | InChI=1S/C9H9NO3/c11-6-1-2-7(12)8-5(6)3-4-10-9(8)13/h1-2,11-12H,3-4H2,(H,10,13) |
| InChIKey | PTUVUVXNMOJJBJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one (CID 117046400) is 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one is O=C1NCCc2c(O)ccc(O)c21.
What is the InChIKey of 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is PTUVUVXNMOJJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-6-1-2-7(12)8-5(6)3-4-10-9(8)13/h1-2,11-12H,3-4H2,(H,10,13).
What are the key properties of 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one?
5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 179.18 g/mol, XLogP of 0.38, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dihydroxy-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 117046400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).