C9H17NO2 — CID 117046492
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5,8-diol (PubChem CID 117046492) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5,8-diol.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5,8-diol |
|---|---|
| PubChem CID | 117046492 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5,8-diol |
| SMILES | OC1CCC(O)C2CNCCC12 |
| InChI | InChI=1S/C9H17NO2/c11-8-1-2-9(12)7-5-10-4-3-6(7)8/h6-12H,1-5H2 |
| InChIKey | ONLKXSBZJKCQEI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |