C11H12ClF3N2 — CID 117047146
3-(3-amino-4,4,4-trifluorobutyl)benzonitrile;hydrochloride (PubChem CID 117047146) has the molecular formula C11H12ClF3N2 and a molecular weight of 264.68 g/mol. Its IUPAC name is 3-(3-amino-4,4,4-trifluorobutyl)benzonitrile;hydrochloride.
| Compound Name | 3-(3-amino-4,4,4-trifluorobutyl)benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 117047146 |
| Molecular Formula | C11H12ClF3N2 |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-(3-amino-4,4,4-trifluorobutyl)benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccc(CCC(N)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2.ClH/c12-11(13,14)10(16)5-4-8-2-1-3-9(6-8)7-15;/h1-3,6,10H,4-5,16H2;1H |
| InChIKey | CCWQMPAYGNZZNE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |