C10H11F3N2O2 — CID 117047399
1,1,1-trifluoro-4-(2-nitrophenyl)butan-2-amine (PubChem CID 117047399) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(2-nitrophenyl)butan-2-amine.
| Compound Name | 1,1,1-trifluoro-4-(2-nitrophenyl)butan-2-amine |
|---|---|
| PubChem CID | 117047399 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1,1,1-trifluoro-4-(2-nitrophenyl)butan-2-amine |
| SMILES | NC(CCc1ccccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)9(14)6-5-7-3-1-2-4-8(7)15(16)17/h1-4,9H,5-6,14H2 |
| InChIKey | DOOKRKFGBQCQAL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|