C24H31ClO5 — CID 11704751
5-chloro-3-[(2E,6E)-7-(5,5-dimethyl-4-oxooxolan-2-yl)-3-methylocta-2,6-dienyl]-2-hydroxy-4-methoxy-6-methylbenzaldehyde (PubChem CID 11704751) has the molecular formula C24H31ClO5 and a molecular weight of 434.96 g/mol. Its IUPAC name is 5-chloro-3-[(2E,6E)-7-(5,5-dimethyl-4-oxooxolan-2-yl)-3-methylocta-2,6-dienyl]-2-hydroxy-4-methoxy-6-methylbenzaldehyde.
| Compound Name | 5-chloro-3-[(2E,6E)-7-(5,5-dimethyl-4-oxooxolan-2-yl)-3-methylocta-2,6-dienyl]-2-hydroxy-4-methoxy-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 11704751 |
| Molecular Formula | C24H31ClO5 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 5-chloro-3-[(2E,6E)-7-(5,5-dimethyl-4-oxooxolan-2-yl)-3-methylocta-2,6-dienyl]-2-hydroxy-4-methoxy-6-methylbenzaldehyde |
| SMILES | COc1c(Cl)c(C)c(C=O)c(O)c1C/C=C(\C)CC/C=C(\C)C1CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C24H31ClO5/c1-14(8-7-9-15(2)19-12-20(27)24(4,5)30-19)10-11-17-22(28)18(13-26)16(3)21(25)23(17)29-6/h9-10,13,19,28H,7-8,11-12H2,1-6H3/b14-10+,15-9+ |
| InChIKey | HOEXWSYPWQXJFN-WEIBIQTGSA-N |
| XLogP | 5.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|