C13H15ClO — CID 117047620
2-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoyl chloride (PubChem CID 117047620) has the molecular formula C13H15ClO and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoyl chloride.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoyl chloride |
|---|---|
| PubChem CID | 117047620 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoyl chloride |
| SMILES | CC(C(=O)Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H15ClO/c1-9(13(14)15)11-7-6-10-4-2-3-5-12(10)8-11/h6-9H,2-5H2,1H3 |
| InChIKey | IQDFCYYPJKNEPD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|