About 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride
2-(2,5-difluorophenyl)-2-methylbutanoyl chloride (PubChem CID 117047827) has the molecular formula C11H11ClF2O
and a molecular weight of 232.66 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride.
Molecular Properties
| Compound Name | 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride |
| PubChem CID | 117047827 |
| Molecular Formula | C11H11ClF2O |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride |
| SMILES | CCC(C)(C(=O)Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H11ClF2O/c1-3-11(2,10(12)15)8-6-7(13)4-5-9(8)14/h4-6H,3H2,1-2H3 |
| InChIKey | ZAONONYBQIRHRK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride?
The IUPAC name of 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride (CID 117047827) is 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride.
What is the SMILES notation for 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride?
The canonical SMILES for 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride is CCC(C)(C(=O)Cl)c1cc(F)ccc1F.
What is the InChIKey of 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride?
The InChIKey is ZAONONYBQIRHRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2O/c1-3-11(2,10(12)15)8-6-7(13)4-5-9(8)14/h4-6H,3H2,1-2H3.
What are the key properties of 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride?
2-(2,5-difluorophenyl)-2-methylbutanoyl chloride has a molecular weight of 232.66 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-2-methylbutanoyl chloride is sourced from PubChem (CID 117047827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).