C18H18F2O2 — CID 117048127
ethyl 2-(3,5-difluorophenyl)-2-methyl-3-phenylpropanoate (PubChem CID 117048127) has the molecular formula C18H18F2O2 and a molecular weight of 304.34 g/mol. Its IUPAC name is ethyl 2-(3,5-difluorophenyl)-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl 2-(3,5-difluorophenyl)-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 117048127 |
| Molecular Formula | C18H18F2O2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | ethyl 2-(3,5-difluorophenyl)-2-methyl-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccccc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H18F2O2/c1-3-22-17(21)18(2,12-13-7-5-4-6-8-13)14-9-15(19)11-16(20)10-14/h4-11H,3,12H2,1-2H3 |
| InChIKey | PLJZQNDRAMFZDK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |