About (4-pyridin-2-ylphenyl) 2-hydroxyacetate
(4-pyridin-2-ylphenyl) 2-hydroxyacetate (PubChem CID 117051700) has the molecular formula C13H11NO3
and a molecular weight of 229.23 g/mol. Its IUPAC name is (4-pyridin-2-ylphenyl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (4-pyridin-2-ylphenyl) 2-hydroxyacetate |
| PubChem CID | 117051700 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (4-pyridin-2-ylphenyl) 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C13H11NO3/c15-9-13(16)17-11-6-4-10(5-7-11)12-3-1-2-8-14-12/h1-8,15H,9H2 |
| InChIKey | WSZBZGIHUMRERU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-pyridin-2-ylphenyl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyridin-2-ylphenyl) 2-hydroxyacetate?
The IUPAC name of (4-pyridin-2-ylphenyl) 2-hydroxyacetate (CID 117051700) is (4-pyridin-2-ylphenyl) 2-hydroxyacetate.
What is the SMILES notation for (4-pyridin-2-ylphenyl) 2-hydroxyacetate?
The canonical SMILES for (4-pyridin-2-ylphenyl) 2-hydroxyacetate is O=C(CO)Oc1ccc(-c2ccccn2)cc1.
What is the InChIKey of (4-pyridin-2-ylphenyl) 2-hydroxyacetate?
The InChIKey is WSZBZGIHUMRERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c15-9-13(16)17-11-6-4-10(5-7-11)12-3-1-2-8-14-12/h1-8,15H,9H2.
What are the key properties of (4-pyridin-2-ylphenyl) 2-hydroxyacetate?
(4-pyridin-2-ylphenyl) 2-hydroxyacetate has a molecular weight of 229.23 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyridin-2-ylphenyl) 2-hydroxyacetate is sourced from PubChem (CID 117051700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).