About 1H-indazol-5-yl 2-hydroxyacetate
1H-indazol-5-yl 2-hydroxyacetate (PubChem CID 117051739) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 1H-indazol-5-yl 2-hydroxyacetate.
Molecular Properties
| Compound Name | 1H-indazol-5-yl 2-hydroxyacetate |
| PubChem CID | 117051739 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 1H-indazol-5-yl 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C9H8N2O3/c12-5-9(13)14-7-1-2-8-6(3-7)4-10-11-8/h1-4,12H,5H2,(H,10,11) |
| InChIKey | XBGJJUXTQSQCKL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazol-5-yl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-5-yl 2-hydroxyacetate?
The IUPAC name of 1H-indazol-5-yl 2-hydroxyacetate (CID 117051739) is 1H-indazol-5-yl 2-hydroxyacetate.
What is the SMILES notation for 1H-indazol-5-yl 2-hydroxyacetate?
The canonical SMILES for 1H-indazol-5-yl 2-hydroxyacetate is O=C(CO)Oc1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazol-5-yl 2-hydroxyacetate?
The InChIKey is XBGJJUXTQSQCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c12-5-9(13)14-7-1-2-8-6(3-7)4-10-11-8/h1-4,12H,5H2,(H,10,11).
What are the key properties of 1H-indazol-5-yl 2-hydroxyacetate?
1H-indazol-5-yl 2-hydroxyacetate has a molecular weight of 192.17 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-5-yl 2-hydroxyacetate is sourced from PubChem (CID 117051739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).