C27H48O4Si — CID 11705370
tert-butyl-[(E,3R,4R,5R,6S)-5-methoxy-1-[(4-methoxyphenyl)methoxy]-4,6-dimethyldec-8-en-3-yl]oxy-dimethylsilane (PubChem CID 11705370) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is tert-butyl-[(E,3R,4R,5R,6S)-5-methoxy-1-[(4-methoxyphenyl)methoxy]-4,6-dimethyldec-8-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3R,4R,5R,6S)-5-methoxy-1-[(4-methoxyphenyl)methoxy]-4,6-dimethyldec-8-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11705370 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | tert-butyl-[(E,3R,4R,5R,6S)-5-methoxy-1-[(4-methoxyphenyl)methoxy]-4,6-dimethyldec-8-en-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](CCOCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O4Si/c1-11-12-13-21(2)26(29-8)22(3)25(31-32(9,10)27(4,5)6)18-19-30-20-23-14-16-24(28-7)17-15-23/h11-12,14-17,21-22,25-26H,13,18-20H2,1-10H3/b12-11+/t21-,22-,25+,26+/m0/s1 |
| InChIKey | RXLRQFRDDOKIJE-FMDMDUKZSA-N |
| XLogP | 7.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|