C20H21ClN2O3 — CID 117054351
4-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidin-3-yl]oxy-1,6-dimethylpyridin-2-one (PubChem CID 117054351) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 4-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidin-3-yl]oxy-1,6-dimethylpyridin-2-one.
| Compound Name | 4-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidin-3-yl]oxy-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 117054351 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidin-3-yl]oxy-1,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(OC2CCN(C(=O)/C=C/c3ccc(Cl)cc3)C2)cc(=O)n1C |
| InChI | InChI=1S/C20H21ClN2O3/c1-14-11-18(12-20(25)22(14)2)26-17-9-10-23(13-17)19(24)8-5-15-3-6-16(21)7-4-15/h3-8,11-12,17H,9-10,13H2,1-2H3/b8-5+ |
| InChIKey | VYMBOAFHVMLKTF-VMPITWQZSA-N |
| XLogP | 3.04 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|