C22H23F3N2O5 — CID 117054485
(E)-1-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 117054485) has the molecular formula C22H23F3N2O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is (E)-1-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 117054485 |
| Molecular Formula | C22H23F3N2O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (E)-1-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCC(Oc3cc(C(F)(F)F)ccn3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C22H23F3N2O5/c1-29-17-10-14(11-18(30-2)21(17)31-3)4-5-20(28)27-9-7-16(13-27)32-19-12-15(6-8-26-19)22(23,24)25/h4-6,8,10-12,16H,7,9,13H2,1-3H3/b5-4+ |
| InChIKey | AJTPAKQVJUVCGT-SNAWJCMRSA-N |
| XLogP | 3.82 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|