C18H18ClN3O2 — CID 117054772
(E)-3-(2-chlorophenyl)-1-(3-pyrazin-2-yloxypiperidin-1-yl)prop-2-en-1-one (PubChem CID 117054772) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-(3-pyrazin-2-yloxypiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-(3-pyrazin-2-yloxypiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 117054772 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-(3-pyrazin-2-yloxypiperidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCCC(Oc2cnccn2)C1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-16-6-2-1-4-14(16)7-8-18(23)22-11-3-5-15(13-22)24-17-12-20-9-10-21-17/h1-2,4,6-10,12,15H,3,5,11,13H2/b8-7+ |
| InChIKey | YCTIWWSZYMKYTB-BQYQJAHWSA-N |
| XLogP | 3.21 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|