C24H25FN4O2S — CID 117056629
7-acetyl-6-(2-fluorophenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117056629) has the molecular formula C24H25FN4O2S and a molecular weight of 452.56 g/mol. Its IUPAC name is 7-acetyl-6-(2-fluorophenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(2-fluorophenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117056629 |
| Molecular Formula | C24H25FN4O2S |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 7-acetyl-6-(2-fluorophenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CCCCCCSc1nc([O-])c2[n+](n1)C(c1ccccc1F)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H25FN4O2S/c1-3-4-5-10-15-32-24-26-22(31)21-18-12-7-9-14-20(18)28(16(2)30)23(29(21)27-24)17-11-6-8-13-19(17)25/h6-9,11-14,23H,3-5,10,15H2,1-2H3 |
| InChIKey | CYERVCVWCZGDQW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|