C22H24N4O2S2 — CID 117058191
7-acetyl-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117058191) has the molecular formula C22H24N4O2S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 7-acetyl-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117058191 |
| Molecular Formula | C22H24N4O2S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 7-acetyl-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CCCCCSc1nc([O-])c2[n+](n1)C(c1ccc(C)s1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H24N4O2S2/c1-4-5-8-13-29-22-23-20(28)19-16-9-6-7-10-17(16)25(15(3)27)21(26(19)24-22)18-12-11-14(2)30-18/h6-7,9-12,21H,4-5,8,13H2,1-3H3 |
| InChIKey | CKKAYUDUMDFOPF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|