C16H14F6N2O5S2 — CID 11705887
3-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-N-methylbenzene-1,3-disulfonamide (PubChem CID 11705887) has the molecular formula C16H14F6N2O5S2 and a molecular weight of 492.42 g/mol. Its IUPAC name is 3-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-N-methylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-N-methylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 11705887 |
| Molecular Formula | C16H14F6N2O5S2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 3-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-N-methylbenzene-1,3-disulfonamide |
| SMILES | CN(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H14F6N2O5S2/c1-24(31(28,29)13-4-2-3-12(9-13)30(23,26)27)11-7-5-10(6-8-11)14(25,15(17,18)19)16(20,21)22/h2-9,25H,1H3,(H2,23,26,27) |
| InChIKey | YGJMGSFABPBUSU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |