About (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate
(3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate (PubChem CID 117058928) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate.
Molecular Properties
| Compound Name | (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate |
| PubChem CID | 117058928 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate |
| SMILES | Cc1cccc(COC(=O)C2=CCCON2)c1 |
| InChI | InChI=1S/C13H15NO3/c1-10-4-2-5-11(8-10)9-16-13(15)12-6-3-7-17-14-12/h2,4-6,8,14H,3,7,9H2,1H3 |
| InChIKey | QGJQGNVBBQCDEI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate?
The IUPAC name of (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate (CID 117058928) is (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate.
What is the SMILES notation for (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate?
The canonical SMILES for (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate is Cc1cccc(COC(=O)C2=CCCON2)c1.
What is the InChIKey of (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate?
The InChIKey is QGJQGNVBBQCDEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-10-4-2-5-11(8-10)9-16-13(15)12-6-3-7-17-14-12/h2,4-6,8,14H,3,7,9H2,1H3.
What are the key properties of (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate?
(3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methyl 5,6-dihydro-2H-oxazine-3-carboxylate is sourced from PubChem (CID 117058928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).