C10H14N2O5S — CID 117059190
4-ethoxy-N,N-dimethyl-2-nitrobenzenesulfonamide (PubChem CID 117059190) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-ethoxy-N,N-dimethyl-2-nitrobenzenesulfonamide.
| Compound Name | 4-ethoxy-N,N-dimethyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 117059190 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-ethoxy-N,N-dimethyl-2-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N2O5S/c1-4-17-8-5-6-10(9(7-8)12(13)14)18(15,16)11(2)3/h5-7H,4H2,1-3H3 |
| InChIKey | HENMVFZLWCJYNO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|