About CID 11705972
CID 11705972 (PubChem CID 11705972) has the molecular formula C26H19NP
and a molecular weight of 376.42 g/mol.
Molecular Properties
| Compound Name | CID 11705972 |
| PubChem CID | 11705972 |
| Molecular Formula | C26H19NP |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][C](c2nccc3ccccc23)[C](P(c2ccccc2)c2ccccc2)[CH]1 |
| InChI | InChI=1S/C26H19NP/c1-3-11-21(12-4-1)28(22-13-5-2-6-14-22)25-17-9-16-24(25)26-23-15-8-7-10-20(23)18-19-27-26/h1-19H |
| InChIKey | QRVAVKUDNNSQPN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11705972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11705972?
The IUPAC name of CID 11705972 (CID 11705972) is not available.
What is the SMILES notation for CID 11705972?
The canonical SMILES for CID 11705972 is [CH]1[CH][C](c2nccc3ccccc23)[C](P(c2ccccc2)c2ccccc2)[CH]1.
What is the InChIKey of CID 11705972?
The InChIKey is QRVAVKUDNNSQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19NP/c1-3-11-21(12-4-1)28(22-13-5-2-6-14-22)25-17-9-16-24(25)26-23-15-8-7-10-20(23)18-19-27-26/h1-19H.
What are the key properties of CID 11705972?
CID 11705972 has a molecular weight of 376.42 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11705972 is sourced from PubChem (CID 11705972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).