C8H7Cl3O3 — CID 117060174
2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d][1,3]dioxin-4-one (PubChem CID 117060174) has the molecular formula C8H7Cl3O3 and a molecular weight of 257.50 g/mol. Its IUPAC name is 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d][1,3]dioxin-4-one.
| Compound Name | 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 117060174 |
| Molecular Formula | C8H7Cl3O3 |
| Molecular Weight | 257.50 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d][1,3]dioxin-4-one |
| SMILES | O=C1OC(C(Cl)(Cl)Cl)OC2=C1CCC2 |
| InChI | InChI=1S/C8H7Cl3O3/c9-8(10,11)7-13-5-3-1-2-4(5)6(12)14-7/h7H,1-3H2 |
| InChIKey | MFOYWPPZRJWEGF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|