About (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate
(4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate (PubChem CID 117060180) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate.
Molecular Properties
| Compound Name | (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate |
| PubChem CID | 117060180 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate |
| SMILES | CC1(C)N=C(OC(=O)Nc2ccccc2)NC1=O |
| InChI | InChI=1S/C12H13N3O3/c1-12(2)9(16)14-10(15-12)18-11(17)13-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,13,17)(H,14,15,16) |
| InChIKey | RZCACCJNOCPBER-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate?
The IUPAC name of (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate (CID 117060180) is (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate.
What is the SMILES notation for (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate?
The canonical SMILES for (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate is CC1(C)N=C(OC(=O)Nc2ccccc2)NC1=O.
What is the InChIKey of (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate?
The InChIKey is RZCACCJNOCPBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c1-12(2)9(16)14-10(15-12)18-11(17)13-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,13,17)(H,14,15,16).
What are the key properties of (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate?
(4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate has a molecular weight of 247.25 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-5-oxo-1H-imidazol-2-yl) N-phenylcarbamate is sourced from PubChem (CID 117060180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).