About CID 117060276
CID 117060276 (PubChem CID 117060276) has the molecular formula C18H14Cl2Ti
and a molecular weight of 349.08 g/mol.
Molecular Properties
| Compound Name | CID 117060276 |
| PubChem CID | 117060276 |
| Molecular Formula | C18H14Cl2Ti |
| Molecular Weight | 349.08 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | — |
| SMILES | Cl[Ti]Cl.[CH]1[CH][C]2C=CC=C[C]2[CH]1.[CH]1[CH][C]2C=CC=C[C]2[CH]1 |
| InChI | InChI=1S/2C9H7.2ClH.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;;;/h2*1-7H;2*1H;/q;;;;+2/p-2 |
| InChIKey | JXBKMHHGNJJERO-UHFFFAOYSA-L |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.08 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 117060276 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 117060276?
The IUPAC name of CID 117060276 (CID 117060276) is not available.
What is the SMILES notation for CID 117060276?
The canonical SMILES for CID 117060276 is Cl[Ti]Cl.[CH]1[CH][C]2C=CC=C[C]2[CH]1.[CH]1[CH][C]2C=CC=C[C]2[CH]1.
What is the InChIKey of CID 117060276?
The InChIKey is JXBKMHHGNJJERO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H7.2ClH.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;;;/h2*1-7H;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 117060276?
CID 117060276 has a molecular weight of 349.08 g/mol, XLogP of 5.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 117060276 is sourced from PubChem (CID 117060276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).