C15H22OS — CID 117060708
2,4,4-trimethyl-6-(1-phenylethyl)-1,3-oxathiane (PubChem CID 117060708) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is 2,4,4-trimethyl-6-(1-phenylethyl)-1,3-oxathiane.
| Compound Name | 2,4,4-trimethyl-6-(1-phenylethyl)-1,3-oxathiane |
|---|---|
| PubChem CID | 117060708 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2,4,4-trimethyl-6-(1-phenylethyl)-1,3-oxathiane |
| SMILES | CC1OC(C(C)c2ccccc2)CC(C)(C)S1 |
| InChI | InChI=1S/C15H22OS/c1-11(13-8-6-5-7-9-13)14-10-15(3,4)17-12(2)16-14/h5-9,11-12,14H,10H2,1-4H3 |
| InChIKey | MGGVEERXNOMFQH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |