C9H6F2N4O2 — CID 117061152
4-[(E)-(2,5-difluorophenyl)methylideneamino]-1,2,4-triazolidine-3,5-dione (PubChem CID 117061152) has the molecular formula C9H6F2N4O2 and a molecular weight of 240.17 g/mol. Its IUPAC name is 4-[(E)-(2,5-difluorophenyl)methylideneamino]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[(E)-(2,5-difluorophenyl)methylideneamino]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 117061152 |
| Molecular Formula | C9H6F2N4O2 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-[(E)-(2,5-difluorophenyl)methylideneamino]-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1/N=C/c1cc(F)ccc1F |
| InChI | InChI=1S/C9H6F2N4O2/c10-6-1-2-7(11)5(3-6)4-12-15-8(16)13-14-9(15)17/h1-4H,(H,13,16)(H,14,17)/b12-4+ |
| InChIKey | PGWVUQUWCYLPKR-UUILKARUSA-N |
| XLogP | 0.03 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|