C22H36O13 — CID 11706142
methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-[(3R,4R,5S,6S)-2-acetyloxy-3,5-dimethoxy-4,6-dimethyloxan-4-yl]oxy-3,4-dimethoxyoxane-2-carboxylate (PubChem CID 11706142) has the molecular formula C22H36O13 and a molecular weight of 508.52 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-[(3R,4R,5S,6S)-2-acetyloxy-3,5-dimethoxy-4,6-dimethyloxan-4-yl]oxy-3,4-dimethoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-[(3R,4R,5S,6S)-2-acetyloxy-3,5-dimethoxy-4,6-dimethyloxan-4-yl]oxy-3,4-dimethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11706142 |
| Molecular Formula | C22H36O13 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-[(3R,4R,5S,6S)-2-acetyloxy-3,5-dimethoxy-4,6-dimethyloxan-4-yl]oxy-3,4-dimethoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](O[C@@]2(C)[C@@H](OC)C(OC(C)=O)O[C@@H](C)[C@@H]2OC)[C@H](OC(C)=O)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C22H36O13/c1-10-17(28-7)22(4,18(29-8)21(31-10)33-12(3)24)35-20-16(32-11(2)23)14(27-6)13(26-5)15(34-20)19(25)30-9/h10,13-18,20-21H,1-9H3/t10-,13-,14-,15-,16+,17-,18-,20-,21?,22+/m0/s1 |
| InChIKey | JXWCVMLZSDDPHH-NTQWGGMQSA-N |
| XLogP | -0.04 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|