C11H16N2O4S — CID 117061646
methyl 2-(4-methylidene-2,2-dioxo-5,6,7,8-tetrahydro-2λ6,1,3-benzothiadiazin-1-yl)acetate (PubChem CID 117061646) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 2-(4-methylidene-2,2-dioxo-5,6,7,8-tetrahydro-2λ6,1,3-benzothiadiazin-1-yl)acetate.
| Compound Name | methyl 2-(4-methylidene-2,2-dioxo-5,6,7,8-tetrahydro-2λ6,1,3-benzothiadiazin-1-yl)acetate |
|---|---|
| PubChem CID | 117061646 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 2-(4-methylidene-2,2-dioxo-5,6,7,8-tetrahydro-2λ6,1,3-benzothiadiazin-1-yl)acetate |
| SMILES | C=C1NS(=O)(=O)N(CC(=O)OC)C2=C1CCCC2 |
| InChI | InChI=1S/C11H16N2O4S/c1-8-9-5-3-4-6-10(9)13(7-11(14)17-2)18(15,16)12-8/h12H,1,3-7H2,2H3 |
| InChIKey | VSTRXLZLYIGOFO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |