C10H6ClFO3 — CID 117061781
3-(2-chloro-6-fluorophenyl)furan-2,4-diol (PubChem CID 117061781) has the molecular formula C10H6ClFO3 and a molecular weight of 228.61 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)furan-2,4-diol.
| Compound Name | 3-(2-chloro-6-fluorophenyl)furan-2,4-diol |
|---|---|
| PubChem CID | 117061781 |
| Molecular Formula | C10H6ClFO3 |
| Molecular Weight | 228.61 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)furan-2,4-diol |
| SMILES | Oc1coc(O)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H6ClFO3/c11-5-2-1-3-6(12)8(5)9-7(13)4-15-10(9)14/h1-4,13-14H |
| InChIKey | GYZYUSBHQGWDRI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |