C13H22O4 — CID 117062096
methyl 2-[[(2R)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]acetate (PubChem CID 117062096) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is methyl 2-[[(2R)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]acetate.
| Compound Name | methyl 2-[[(2R)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 117062096 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | methyl 2-[[(2R)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]acetate |
| SMILES | COC(=O)CO[C@@H]1CC2(C(C)C)CCC1(C)O2 |
| InChI | InChI=1S/C13H22O4/c1-9(2)13-6-5-12(3,17-13)10(7-13)16-8-11(14)15-4/h9-10H,5-8H2,1-4H3/t10-,12?,13?/m1/s1 |
| InChIKey | XLPZUPHEQRPHIL-QFWMXSHPSA-N |
| XLogP | 1.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |