C12H18N4O — CID 117062361
3-cyclohexylidene-2,6,7,8-tetrahydro-1H-pyrimido[2,1-c][1,2,4]triazin-4-one (PubChem CID 117062361) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-cyclohexylidene-2,6,7,8-tetrahydro-1H-pyrimido[2,1-c][1,2,4]triazin-4-one.
| Compound Name | 3-cyclohexylidene-2,6,7,8-tetrahydro-1H-pyrimido[2,1-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 117062361 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-cyclohexylidene-2,6,7,8-tetrahydro-1H-pyrimido[2,1-c][1,2,4]triazin-4-one |
| SMILES | O=C1C(=C2CCCCC2)NNC2=NCCCN12 |
| InChI | InChI=1S/C12H18N4O/c17-11-10(9-5-2-1-3-6-9)14-15-12-13-7-4-8-16(11)12/h14H,1-8H2,(H,13,15) |
| InChIKey | CKKDDIWHZIBJSF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|